|
CAS#: 86231-09-6 Product: Sodium 3,4,5-trichlorophenolate No suppilers available for the product. |
| Name | Sodium 3,4,5-trichlorophenolate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C6H2Cl3NaO |
| Molecular Weight | 219.43 |
| CAS Registry Number | 86231-09-6 |
| EINECS | 289-208-2 |
| SMILES | [Na+].[O-]c1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | 1S/C6H3Cl3O.Na/c7-4-1-3(10)2-5(8)6(4)9;/h1-2,10H;/q;+1/p-1 |
| InChIKey | NQBODVNQFWZLQQ-UHFFFAOYSA-M |
| Boiling point | 281.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 123.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 3,4,5-trichlorophenolate |