|
CAS#: 86257-08-1 Product: 7-(4,5-Dihydroxypentyl)-1,3-dipropyl-3,7-dihydro-1H-purine-2,6-dione No suppilers available for the product. |
| Name | 7-(4,5-Dihydroxypentyl)-1,3-dipropyl-3,7-dihydro-1H-purine-2,6-dione |
|---|---|
| Synonyms | 1H-Purine |
| Molecular Structure | ![]() |
| Molecular Formula | C16H26N4O4 |
| Molecular Weight | 338.40 |
| CAS Registry Number | 86257-08-1 |
| SMILES | O=C2N(c1ncn(c1C(=O)N2CCC)CCCC(O)CO)CCC |
| InChI | 1S/C16H26N4O4/c1-3-7-19-14-13(15(23)20(8-4-2)16(19)24)18(11-17-14)9-5-6-12(22)10-21/h11-12,21-22H,3-10H2,1-2H3 |
| InChIKey | QGMVTZCLESICHT-UHFFFAOYSA-N |
| Density | 1.314g/cm3 (Cal.) |
|---|---|
| Boiling point | 597.585°C at 760 mmHg (Cal.) |
| Flash point | 315.208°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-(4,5-Dihydroxypentyl)-1,3-dipropyl-3,7-dihydro-1H-purine-2,6-dione |