|
CAS#: 863132-85-8 Product: 6-(2-Oxopropyl)-2,3-dihydro-1,4-benzodioxine-2-carboxylic acid No suppilers available for the product. |
| Name | 6-(2-Oxopropyl)-2,3-dihydro-1,4-benzodioxine-2-carboxylic acid |
|---|---|
| Synonyms | 1,4-BENZO |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12O5 |
| Molecular Weight | 236.22 |
| CAS Registry Number | 863132-85-8 |
| SMILES | CC(=O)Cc1ccc2OC(COc2c1)C(O)=O |
| InChI | 1S/C12H12O5/c1-7(13)4-8-2-3-9-10(5-8)16-6-11(17-9)12(14)15/h2-3,5,11H,4,6H2,1H3,(H,14,15) |
| InChIKey | GSHIVNGJILVEFP-UHFFFAOYSA-N |
| Density | 1.334g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.699°C at 760 mmHg (Cal.) |
| Flash point | 165.376°C (Cal.) |
| Refractive index | 1.561 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(2-Oxopropyl)-2,3-dihydro-1,4-benzodioxine-2-carboxylic acid |