|
CAS#: 86334-99-8 Product: (3S)-8-Hydroxy-1-oxo-2-azaspiro[4.5]deca-6,9-diene-3-carboxylic acid No suppilers available for the product. |
| Name | (3S)-8-Hydroxy-1-oxo-2-azaspiro[4.5]deca-6,9-diene-3-carboxylic acid |
|---|---|
| Synonyms | 2-Azaspir |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 |
| CAS Registry Number | 86334-99-8 |
| SMILES | O=C(O)[C@H]2NC(=O)C\1(\C=C/C(O)/C=C/1)C2 |
| InChI | 1S/C10H11NO4/c12-6-1-3-10(4-2-6)5-7(8(13)14)11-9(10)15/h1-4,6-7,12H,5H2,(H,11,15)(H,13,14)/t6?,7-,10?/m0/s1 |
| InChIKey | LXSZSKUQMSFKSN-DSQUFTABSA-N |
| Density | 1.475g/cm3 (Cal.) |
|---|---|
| Boiling point | 581.033°C at 760 mmHg (Cal.) |
| Flash point | 305.198°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3S)-8-Hydroxy-1-oxo-2-azaspiro[4.5]deca-6,9-diene-3-carboxylic acid |