|
CAS#: 86398-89-2 Product: 1-[2-(Diethylamino)-3-propoxypropyl]-3-phenylurea No suppilers available for the product. |
| Name | 1-[2-(Diethylamino)-3-propoxypropyl]-3-phenylurea |
|---|---|
| Synonyms | N-(2-(Diethylamino)-3-propoxypropyl)-N'-phenylurea; Urea, N-(2-(diethylamino)-3-propoxypropyl)-N'-phenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.43 |
| CAS Registry Number | 86398-89-2 |
| SMILES | O=C(Nc1ccccc1)NCC(N(CC)CC)COCCC |
| InChI | 1S/C17H29N3O2/c1-4-12-22-14-16(20(5-2)6-3)13-18-17(21)19-15-10-8-7-9-11-15/h7-11,16H,4-6,12-14H2,1-3H3,(H2,18,19,21) |
| InChIKey | KIQIGQOPBDMNQR-UHFFFAOYSA-N |
| Density | 1.046g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.974°C at 760 mmHg (Cal.) |
| Flash point | 204.165°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[2-(Diethylamino)-3-propoxypropyl]-3-phenylurea |