|
CAS#: 86427-44-3 Product: 2-(1H-Indol-3-yl)-3-(2-phenylethyl)-1,3-thiazolidin-4-one No suppilers available for the product. |
| Name | 2-(1H-Indol-3-yl)-3-(2-phenylethyl)-1,3-thiazolidin-4-one |
|---|---|
| Synonyms | 2-(1H-Indol-3-yl)-3-(2-phenylethyl)-4-thiazolidinone; 4-Thiazolidinone, 2-(1H-indol-3-yl)-3-(2-phenylethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C19H18N2OS |
| Molecular Weight | 322.42 |
| CAS Registry Number | 86427-44-3 |
| SMILES | O=C2N(CCc1ccccc1)C(SC2)c4c3ccccc3nc4 |
| InChI | 1S/C19H18N2OS/c22-18-13-23-19(16-12-20-17-9-5-4-8-15(16)17)21(18)11-10-14-6-2-1-3-7-14/h1-9,12,19-20H,10-11,13H2 |
| InChIKey | LDDYPGMGUXNFFQ-UHFFFAOYSA-N |
| Density | 1.286g/cm3 (Cal.) |
|---|---|
| Boiling point | 605.558°C at 760 mmHg (Cal.) |
| Flash point | 320.03°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(1H-Indol-3-yl)-3-(2-phenylethyl)-1,3-thiazolidin-4-one |