|
CAS#: 864539-94-6 Product: 2-Methyl-2-propanyl {2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl}carbamate No suppilers available for the product. |
| Name | 2-Methyl-2-propanyl {2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl}carbamate |
|---|---|
| Synonyms | [2-hydrox |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18F3NO3 |
| Molecular Weight | 305.29 |
| CAS Registry Number | 864539-94-6 |
| SMILES | FC(F)(F)c1ccc(cc1)C(O)CNC(=O)OC(C)(C)C |
| InChI | 1S/C14H18F3NO3/c1-13(2,3)21-12(20)18-8-11(19)9-4-6-10(7-5-9)14(15,16)17/h4-7,11,19H,8H2,1-3H3,(H,18,20) |
| InChIKey | QRVMLXMOYYJIEC-UHFFFAOYSA-N |
| Density | 1.227g/cm3 (Cal.) |
|---|---|
| Boiling point | 399.976°C at 760 mmHg (Cal.) |
| Flash point | 195.698°C (Cal.) |
| Refractive index | 1.48 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-propanyl {2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl}carbamate |