|
CAS#: 864754-12-1 Product: 2-[2-(1,3-Dioxolan-2-ylmethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane No suppilers available for the product. |
| Name | 2-[2-(1,3-Dioxolan-2-ylmethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| Synonyms | 1,3,2-DIO |
| Molecular Structure | ![]() |
| Molecular Formula | C16H23BO5 |
| Molecular Weight | 306.16 |
| CAS Registry Number | 864754-12-1 |
| SMILES | CC1(C)OB(OC1(C)C)c3ccccc3OCC2OCCO2 |
| InChI | 1S/C16H23BO5/c1-15(2)16(3,4)22-17(21-15)12-7-5-6-8-13(12)20-11-14-18-9-10-19-14/h5-8,14H,9-11H2,1-4H3 |
| InChIKey | MWZSVLSZRVYSFZ-UHFFFAOYSA-N |
| Density | 1.133g/cm3 (Cal.) |
|---|---|
| Boiling point | 423.318°C at 760 mmHg (Cal.) |
| Flash point | 209.815°C (Cal.) |
| Refractive index | 1.512 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[2-(1,3-Dioxolan-2-ylmethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |