|
CAS#: 864754-45-0 Product: 4,4,5,5-Tetramethyl-2-(3-{[(trifluoromethyl)sulfanyl]methoxy}phenyl)-1,3,2-dioxaborolane No suppilers available for the product. |
| Name | 4,4,5,5-Tetramethyl-2-(3-{[(trifluoromethyl)sulfanyl]methoxy}phenyl)-1,3,2-dioxaborolane |
|---|---|
| Synonyms | 1,3,2-DIO |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18BF3O3S |
| Molecular Weight | 334.16 |
| CAS Registry Number | 864754-45-0 |
| SMILES | CC1(C)OB(OC1(C)C)c2cccc(OCSC(F)(F)F)c2 |
| InChI | 1S/C14H18BF3O3S/c1-12(2)13(3,4)21-15(20-12)10-6-5-7-11(8-10)19-9-22-14(16,17)18/h5-8H,9H2,1-4H3 |
| InChIKey | FNIHKVOSMCYOCS-UHFFFAOYSA-N |
| Density | 1.224g/cm3 (Cal.) |
|---|---|
| Boiling point | 372.045°C at 760 mmHg (Cal.) |
| Flash point | 178.807°C (Cal.) |
| Refractive index | 1.489 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4,5,5-Tetramethyl-2-(3-{[(trifluoromethyl)sulfanyl]methoxy}phenyl)-1,3,2-dioxaborolane |