Online Database of Chemicals from Around the World
| Name | 1,1,1,2,2,3,4,4,5,5,5-Undecafluoro-3-(Trifluoromethyl)Pentane |
|---|---|
| Synonyms | Perfluoro-3-Methylpentane; Pentane, 1,1,1,2,2,3,4,4,5,5,5-Undecafluoro-3-(Trifluoromethyl)- |
| Molecular Structure |  |
| Molecular Formula | C6F14 |
| Molecular Weight | 338.04 |
| CAS Registry Number | 865-71-4 |
| EINECS | 212-746-6 |
| SMILES | FC(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | 1S/C6F14/c7-1(4(12,13)14,2(8,9)5(15,16)17)3(10,11)6(18,19)20 |
| InChIKey | GXSFAIDPYIEIEF-UHFFFAOYSA-N |
| Density | 1.656g/cm3 (Cal.) |
|---|---|
| Boiling point | 58.199°C at 760 mmHg (Cal.) |
| Flash point | 1.412°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,1,2,2,3,4,4,5,5,5-Undecafluoro-3-(Trifluoromethyl)Pentane |
