|
CAS#: 86504-33-8 Product: 3,4,5-Triphenyl-3-cyclopentene-1,2-dione No suppilers available for the product. |
| Name | 3,4,5-Triphenyl-3-cyclopentene-1,2-dione |
|---|---|
| Synonyms | NSC80695 |
| Molecular Structure | ![]() |
| Molecular Formula | C23H16O2 |
| Molecular Weight | 324.37 |
| CAS Registry Number | 86504-33-8 |
| SMILES | O=C4C(/c1ccccc1)=C(/c2ccccc2)C(c3ccccc3)C4=O |
| InChI | 1S/C23H16O2/c24-22-20(17-12-6-2-7-13-17)19(16-10-4-1-5-11-16)21(23(22)25)18-14-8-3-9-15-18/h1-15,20H |
| InChIKey | WNICCJYXHMFPLS-UHFFFAOYSA-N |
| Density | 1.231g/cm3 (Cal.) |
|---|---|
| Boiling point | 491.549°C at 760 mmHg (Cal.) |
| Flash point | 214.03°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4,5-Triphenyl-3-cyclopentene-1,2-dione |