|
CAS#: 86527-19-7 Product: 7-(6-Deoxy-beta-L-mannofuranosyl)-3,7-dihydro-6H-purin-6-one No suppilers available for the product. |
| Name | 7-(6-Deoxy-beta-L-mannofuranosyl)-3,7-dihydro-6H-purin-6-one |
|---|---|
| Synonyms | 6H-Purin-6-one, 7-(6-deoxy-α-L-talofuranosyl)-1,7-dihydro-; 7-(6'-Deoxytalofuranosyl)hypoxanthine; 7-(6'-Deoxy-α-L-talofuranosyl)hypoxanthine |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14N4O5 |
| Molecular Weight | 282.25 |
| CAS Registry Number | 86527-19-7 |
| SMILES | O=C2\N=C/Nc1ncn(c12)[C@H]3O[C@H]([C@@H](O)[C@H]3O)[C@@H](O)C |
| InChI | 1S/C11H14N4O5/c1-4(16)8-6(17)7(18)11(20-8)15-3-14-9-5(15)10(19)13-2-12-9/h2-4,6-8,11,16-18H,1H3,(H,12,13,19)/t4-,6-,7+,8-,11-/m0/s1 |
| InChIKey | DQHCWWAARZMHKW-UBJKSCQCSA-N |
| Density | 1.962g/cm3 (Cal.) |
|---|---|
| Boiling point | 702.279°C at 760 mmHg (Cal.) |
| Flash point | 378.525°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-(6-Deoxy-beta-L-mannofuranosyl)-3,7-dihydro-6H-purin-6-one |