|
CAS#: 86548-95-0 Product: 5-Methyl-2,4-bis(2-oxiranylmethyl)-2,4-dihydro-3H-1,2,4-triazol-3-one No suppilers available for the product. |
| Name | 5-Methyl-2,4-bis(2-oxiranylmethyl)-2,4-dihydro-3H-1,2,4-triazol-3-one |
|---|---|
| Synonyms | 2,4-Dihyd |
| Molecular Structure | ![]() |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 |
| CAS Registry Number | 86548-95-0 |
| SMILES | O=C1N(\C(=N/N1CC2OC2)C)CC3OC3 |
| InChI | 1S/C9H13N3O3/c1-6-10-12(3-8-5-15-8)9(13)11(6)2-7-4-14-7/h7-8H,2-5H2,1H3 |
| InChIKey | JEACHLMQCZGTIH-UHFFFAOYSA-N |
| Density | 1.655g/cm3 (Cal.) |
|---|---|
| Boiling point | 318.63°C at 760 mmHg (Cal.) |
| Flash point | 146.503°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Methyl-2,4-bis(2-oxiranylmethyl)-2,4-dihydro-3H-1,2,4-triazol-3-one |