|
CAS#: 86579-36-4 Product: N-[4-(2-Methyl-2-butanyl)phenyl]-N'-phenyl-1,4-benzenediamine No suppilers available for the product. |
| Name | N-[4-(2-Methyl-2-butanyl)phenyl]-N'-phenyl-1,4-benzenediamine |
|---|---|
| Synonyms | N-[4-(1,1 |
| Molecular Structure | ![]() |
| Molecular Formula | C23H26N2 |
| Molecular Weight | 330.47 |
| CAS Registry Number | 86579-36-4 |
| EINECS | 289-251-7 |
| SMILES | c3c(Nc1ccc(cc1)Nc2ccccc2)ccc(c3)C(C)(C)CC |
| InChI | 1S/C23H26N2/c1-4-23(2,3)18-10-12-20(13-11-18)25-22-16-14-21(15-17-22)24-19-8-6-5-7-9-19/h5-17,24-25H,4H2,1-3H3 |
| InChIKey | RYHCBSRDOLORRF-UHFFFAOYSA-N |
| Density | 1.085g/cm3 (Cal.) |
|---|---|
| Boiling point | 493.549°C at 760 mmHg (Cal.) |
| Flash point | 302.383°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[4-(2-Methyl-2-butanyl)phenyl]-N'-phenyl-1,4-benzenediamine |