|
CAS#: 86603-66-9 Product: (1s,1's,4s,4'R)-4'-Propyl-1,1'-bi(cyclohexyl)-4-yl 4-(trans-4-propylcyclohexyl)benzoate No suppilers available for the product. |
| Name | (1s,1's,4s,4'R)-4'-Propyl-1,1'-bi(cyclohexyl)-4-yl 4-(trans-4-propylcyclohexyl)benzoate |
|---|---|
| Synonyms | TRANS,TRA |
| Molecular Structure | ![]() |
| Molecular Formula | C31H48O2 |
| Molecular Weight | 452.71 |
| CAS Registry Number | 86603-66-9 |
| SMILES | CCC[C@H]1CC[C@@H](CC1)C2CC[C@@H](CC2)OC(=O)C3=CC=C(C=C3)[C@H]4CC[C@@H](CC4)CCC |
| InChI | 1S/C31H48O2/c1-3-5-23-7-11-25(12-8-23)27-15-17-29(18-16-27)31(32)33-30-21-19-28(20-22-30)26-13-9-24(6-4-2)10-14-26/h15-18,23-26,28,30H,3-14,19-22H2,1-2H3/t23-,24-,25-,26-,28?,30- |
| InChIKey | DHCXQHKQRVGHAQ-GUDFZPBDSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 553.3±29.0°C at 760 mmHg (Cal.) |
| Flash point | 243.4±10.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1s,1's,4s,4'R)-4'-Propyl-1,1'-bi(cyclohexyl)-4-yl 4-(trans-4-propylcyclohexyl)benzoate |