|
CAS#: 86651-05-0 Product: Methyl 8-ethyl-2-methoxy-5-oxo-5,8-dihydropyrido[2,3-d]pyrimidine-6-carboxylate No suppilers available for the product. |
| Name | Methyl 8-ethyl-2-methoxy-5-oxo-5,8-dihydropyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| Synonyms | methyl 8- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 |
| CAS Registry Number | 86651-05-0 |
| EINECS | 289-267-4 |
| SMILES | COC(=O)C2=CN(CC)c1nc(ncc1C2=O)OC |
| InChI | 1S/C12H13N3O4/c1-4-15-6-8(11(17)18-2)9(16)7-5-13-12(19-3)14-10(7)15/h5-6H,4H2,1-3H3 |
| InChIKey | BPFBTKGLQOKVBZ-UHFFFAOYSA-N |
| Density | 1.311g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.26°C at 760 mmHg (Cal.) |
| Flash point | 204.942°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 8-ethyl-2-methoxy-5-oxo-5,8-dihydropyrido[2,3-d]pyrimidine-6-carboxylate |