|
CAS#: 86674-90-0 Product: 4-(Chloromethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane No suppilers available for the product. |
| Name | 4-(Chloromethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H9Cl3O2 |
| Molecular Weight | 267.54 |
| CAS Registry Number | 86674-90-0 |
| EINECS | 289-269-5 |
| SMILES | Clc1cc(Cl)c(cc1)C2OC(CO2)CCl |
| InChI | 1S/C10H9Cl3O2/c11-4-7-5-14-10(15-7)8-2-1-6(12)3-9(8)13/h1-3,7,10H,4-5H2 |
| InChIKey | UWFNCYWHUDMLAD-UHFFFAOYSA-N |
| Density | 1.398g/cm3 (Cal.) |
|---|---|
| Boiling point | 339.874°C at 760 mmHg (Cal.) |
| Flash point | 131.348°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Chloromethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane |