|
CAS#: 86683-94-5 Product: N-(3-Phenyl-1,2-oxazol-5-yl)-3-(1-piperidinyl)butanamide No suppilers available for the product. |
| Name | N-(3-Phenyl-1,2-oxazol-5-yl)-3-(1-piperidinyl)butanamide |
|---|---|
| Synonyms | 1-Piperidinepropanamide, β-methyl-N-(3-phenyl-5-isoxazolyl)-; β-Methyl-N-(3-phenyl-5-isoxazolyl)-1-piperidinepropanamide |
| Molecular Structure | ![]() |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.39 |
| CAS Registry Number | 86683-94-5 |
| SMILES | O=C(Nc2onc(c1ccccc1)c2)CC(N3CCCCC3)C |
| InChI | 1S/C18H23N3O2/c1-14(21-10-6-3-7-11-21)12-17(22)19-18-13-16(20-23-18)15-8-4-2-5-9-15/h2,4-5,8-9,13-14H,3,6-7,10-12H2,1H3,(H,19,22) |
| InChIKey | FQIGUKPEJBVYCJ-UHFFFAOYSA-N |
| Density | 1.168g/cm3 (Cal.) |
|---|---|
| Boiling point | 547.916°C at 760 mmHg (Cal.) |
| Flash point | 285.17°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(3-Phenyl-1,2-oxazol-5-yl)-3-(1-piperidinyl)butanamide |