|
CAS#: 86717-07-9 Product: 1-({5-[(1H-Indol-3-ylmethyl)amino]-1,3,4-thiadiazol-2-yl}sulfanyl)-3-[(2-methylphenyl)amino]-2-propanol No suppilers available for the product. |
| Name | 1-({5-[(1H-Indol-3-ylmethyl)amino]-1,3,4-thiadiazol-2-yl}sulfanyl)-3-[(2-methylphenyl)amino]-2-propanol |
|---|---|
| Synonyms | BRN 6012603 |
| Molecular Structure | ![]() |
| Molecular Formula | C21H23N5OS2 |
| Molecular Weight | 425.57 |
| CAS Registry Number | 86717-07-9 |
| SMILES | OC(CSc1nnc(s1)NCc3c2ccccc2nc3)CNc4ccccc4C |
| InChI | 1S/C21H23N5OS2/c1-14-6-2-4-8-18(14)23-12-16(27)13-28-21-26-25-20(29-21)24-11-15-10-22-19-9-5-3-7-17(15)19/h2-10,16,22-23,27H,11-13H2,1H3,(H,24,25) |
| InChIKey | LQXKAFANMJCRPD-UHFFFAOYSA-N |
| Density | 1.388g/cm3 (Cal.) |
|---|---|
| Boiling point | 725.709°C at 760 mmHg (Cal.) |
| Flash point | 392.695°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-({5-[(1H-Indol-3-ylmethyl)amino]-1,3,4-thiadiazol-2-yl}sulfanyl)-3-[(2-methylphenyl)amino]-2-propanol |