|
CAS#: 86808-62-0 Product: 4-Chlorophenyl 1-methyl-4-nitro-1H-imidazole-5-sulfonate No suppilers available for the product. |
| Name | 4-Chlorophenyl 1-methyl-4-nitro-1H-imidazole-5-sulfonate |
|---|---|
| Synonyms | 4-chlorophenyl 1-methyl-4-nitro-1h-imidazole-5-sulfonate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8ClN3O5S |
| Molecular Weight | 317.71 |
| CAS Registry Number | 86808-62-0 |
| SMILES | CN1C=NC(=C1S(=O)(=O)OC2=CC=C(C=C2)Cl)[N+](=O)[O-] |
| InChI | 1S/C10H8ClN3O5S/c1-13-6-12-9(14(15)16)10(13)20(17,18)19-8-4-2-7(11)3-5-8/h2-6H,1H3 |
| InChIKey | VCBIEXLZPZYLOK-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 577.7±50.0°C at 760 mmHg (Cal.) |
| Flash point | 303.2±30.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chlorophenyl 1-methyl-4-nitro-1H-imidazole-5-sulfonate |