|
CAS#: 86835-91-8 Product: 1-(Isopropylamino)-9,10-anthraquinone No suppilers available for the product. |
| Name | 1-(Isopropylamino)-9,10-anthraquinone |
|---|---|
| Synonyms | 1-((1-Methylethyl)amino)anthraquinone; 1-(1'-Methylethyl)aminoanthracene-9,10-dione; 1-(Isopropylamino)anthraquinone |
| Molecular Structure | ![]() |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 |
| CAS Registry Number | 86835-91-8 |
| SMILES | O=C2c1ccccc1C(=O)c3c2cccc3NC(C)C |
| InChI | 1S/C17H15NO2/c1-10(2)18-14-9-5-8-13-15(14)17(20)12-7-4-3-6-11(12)16(13)19/h3-10,18H,1-2H3 |
| InChIKey | ATIYVSUEHXWMKF-UHFFFAOYSA-N |
| Density | 1.252g/cm3 (Cal.) |
|---|---|
| Boiling point | 470.219°C at 760 mmHg (Cal.) |
| Flash point | 183.422°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Isopropylamino)-9,10-anthraquinone |