|
CAS#: 86852-07-5 Product: (1R,5E,7E,17beta)-1-Hydroxy-17-[(2R)-6-hydroxy-6-methyl-2-heptanyl]-9,10-secoestra-5,7-dien-4-one No suppilers available for the product. |
| Name | (1R,5E,7E,17beta)-1-Hydroxy-17-[(2R)-6-hydroxy-6-methyl-2-heptanyl]-9,10-secoestra-5,7-dien-4-one |
|---|---|
| Synonyms | 10-Keto-25-hydroxyvitamin D3; 10-Khvd; 19-Nor-9, |
| Molecular Structure | ![]() |
| Molecular Formula | C26H42O3 |
| Molecular Weight | 402.61 |
| CAS Registry Number | 86852-07-5 |
| SMILES | O=C3\C(=C\C=C1/CCC[C@]2([C@H]1CC[C@@H]2[C@H](C)CCCC(O)(C)C)C)C[C@H](O)CC3 |
| InChI | 1S/C26H42O3/c1-18(7-5-15-25(2,3)29)22-12-13-23-19(8-6-16-26(22,23)4)9-10-20-17-21(27)11-14-24(20)28/h9-10,18,21-23,27,29H,5-8,11-17H2,1-4H3/b19-9+,20-10+/t18-,21-,22-,23+,26-/m1/s1 |
| InChIKey | WGGXZJFAPUZXLC-NGPZEFBZSA-N |
| Density | 1.117g/cm3 (Cal.) |
|---|---|
| Boiling point | 555.407°C at 760 mmHg (Cal.) |
| Flash point | 303.757°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1R,5E,7E,17beta)-1-Hydroxy-17-[(2R)-6-hydroxy-6-methyl-2-heptanyl]-9,10-secoestra-5,7-dien-4-one |