|
CAS#: 86871-79-6 Product: (2R,3R)-2,3-Dihydroxysuccinic acid - 1-(3-{[5-(4-chlorophenyl)-4-methyl-1H-pyrazol-3-yl]oxy}propyl)piperidine (1:1) No suppilers available for the product. |
| Name | (2R,3R)-2,3-Dihydroxysuccinic acid - 1-(3-{[5-(4-chlorophenyl)-4-methyl-1H-pyrazol-3-yl]oxy}propyl)piperidine (1:1) |
|---|---|
| Synonyms | Piperidin |
| Molecular Structure | ![]() |
| Molecular Formula | C22H30ClN3O7 |
| Molecular Weight | 483.94 |
| CAS Registry Number | 86871-79-6 |
| SMILES | O=C(O)[C@H](O)[C@@H](O)C(=O)O.Clc1ccc(cc1)c2c(c(nn2)OCCCN3CCCCC3)C |
| InChI | 1S/C18H24ClN3O.C4H6O6/c1-14-17(15-6-8-16(19)9-7-15)20-21-18(14)23-13-5-12-22-10-3-2-4-11-22;5-1(3(7)8)2(6)4(9)10/h6-9H,2-5,10-13H2,1H3,(H,20,21);1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/m.1/s1 |
| InChIKey | DEZRLIVCOXPLBI-LREBCSMRSA-N |
| Boiling point | 506°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 259.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R,3R)-2,3-Dihydroxysuccinic acid - 1-(3-{[5-(4-chlorophenyl)-4-methyl-1H-pyrazol-3-yl]oxy}propyl)piperidine (1:1) |