|
CAS#: 86880-40-2 Product: 7-Chloro-9H-fluorene-4-carboxylic acid No suppilers available for the product. |
| Name | 7-Chloro-9H-fluorene-4-carboxylic acid |
|---|---|
| Synonyms | 7-Chloro-9H-fluorene-4-carboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C14H9ClO2 |
| Molecular Weight | 244.67 |
| CAS Registry Number | 86880-40-2 |
| SMILES | C1C2=C(C3=C1C=C(C=C3)Cl)C(=CC=C2)C(=O)O |
| InChI | 1S/C14H9ClO2/c15-10-4-5-11-9(7-10)6-8-2-1-3-12(13(8)11)14(16)17/h1-5,7H,6H2,(H,16,17) |
| InChIKey | KLYWKFQXUGRONV-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 464.2±38.0°C at 760 mmHg (Cal.) |
| Flash point | 234.5±26.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Chloro-9H-fluorene-4-carboxylic acid |