|
CAS#: 86946-16-9 Product: 3-(2,4-Dichlorophenyl)-N,N-dimethyl-1-indanamine No suppilers available for the product. |
| Name | 3-(2,4-Dichlorophenyl)-N,N-dimethyl-1-indanamine |
|---|---|
| Synonyms | DDDPI; N,N-Dimethyl-3-(2',4'-dichlorophenyl)indanamine |
| Molecular Structure | ![]() |
| Molecular Formula | C17H17Cl2N |
| Molecular Weight | 306.23 |
| CAS Registry Number | 86946-16-9 |
| SMILES | CN(C)C1CC(C2=CC=CC=C12)C3=C(C=C(C=C3)Cl)Cl |
| InChI | 1S/C17H17Cl2N/c1-20(2)17-10-15(12-5-3-4-6-14(12)17)13-8-7-11(18)9-16(13)19/h3-9,15,17H,10H2,1-2H3 |
| InChIKey | WVYAYEHQWAYJNS-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 387.3±42.0°C at 760 mmHg (Cal.) |
| Flash point | 188.0±27.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2,4-Dichlorophenyl)-N,N-dimethyl-1-indanamine |