Online Database of Chemicals from Around the World
|
CAS#: 87-97-8 Product: 2,6-Di-Tert-Butyl-4-(Methoxymethyl)Phenol No suppilers available for the product. |
| Name | 2,6-Di-Tert-Butyl-4-(Methoxymethyl)Phenol |
|---|---|
| Synonyms | Nsc 39711; P-Cresol, 2,6-Di-Tert-Butyl-Alpha-Methoxy- |
| Molecular Structure |  |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 |
| CAS Registry Number | 87-97-8 |
| EINECS | 201-787-5 |
| SMILES | C1=C(C(=C(C=C1COC)C(C)(C)C)O)C(C)(C)C |
| InChI | 1S/C16H26O2/c1-15(2,3)12-8-11(10-18-7)9-13(14(12)17)16(4,5)6/h8-9,17H,10H2,1-7H3 |
| InChIKey | SCXYLTWTWUGEAA-UHFFFAOYSA-N |
| Density | 0.961g/cm3 (Cal.) |
|---|---|
| Boiling point | 286.335°C at 760 mmHg (Cal.) |
| Flash point | 90.878°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,6-Di-Tert-Butyl-4-(Methoxymethyl)Phenol |