|
CAS#: 87005-14-9 Product: N-Acetoxy-N-(7-butyl-9H-fluoren-2-yl)acetamide No suppilers available for the product. |
| Name | N-Acetoxy-N-(7-butyl-9H-fluoren-2-yl)acetamide |
|---|---|
| Synonyms | N-Acetoxy-7-N-butyl-N-2-acetylaminofluorene; N-Aco-but-aaf |
| Molecular Structure | ![]() |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.41 |
| CAS Registry Number | 87005-14-9 |
| SMILES | O=C(N(OC(=O)C)c3ccc2c1ccc(cc1Cc2c3)CCCC)C |
| InChI | 1S/C21H23NO3/c1-4-5-6-16-7-9-20-17(11-16)12-18-13-19(8-10-21(18)20)22(14(2)23)25-15(3)24/h7-11,13H,4-6,12H2,1-3H3 |
| InChIKey | LGPMMAJBGGFOKI-UHFFFAOYSA-N |
| Density | 1.181g/cm3 (Cal.) |
|---|---|
| Boiling point | 487.879°C at 760 mmHg (Cal.) |
| Flash point | 248.86°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Acetoxy-N-(7-butyl-9H-fluoren-2-yl)acetamide |