|
CAS#: 870194-63-1 Product: 3-[2-Chloro-4-(2-methoxy-2-oxoethyl)phenyl]-5-methyl-1,2-oxazole-4-carboxylic acid No suppilers available for the product. |
| Name | 3-[2-Chloro-4-(2-methoxy-2-oxoethyl)phenyl]-5-methyl-1,2-oxazole-4-carboxylic acid |
|---|---|
| Synonyms | 4-ISOXAZO |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12ClNO5 |
| Molecular Weight | 309.70 |
| CAS Registry Number | 870194-63-1 |
| SMILES | Cc1c(c(no1)c2ccc(cc2Cl)CC(=O)OC)C(=O)O |
| InChI | 1S/C14H12ClNO5/c1-7-12(14(18)19)13(16-21-7)9-4-3-8(5-10(9)15)6-11(17)20-2/h3-5H,6H2,1-2H3,(H,18,19) |
| InChIKey | ZTNKWBDCXUGSNY-UHFFFAOYSA-N |
| Density | 1.381g/cm3 (Cal.) |
|---|---|
| Boiling point | 439.314°C at 760 mmHg (Cal.) |
| Flash point | 219.49°C (Cal.) |
| Refractive index | 1.572 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[2-Chloro-4-(2-methoxy-2-oxoethyl)phenyl]-5-methyl-1,2-oxazole-4-carboxylic acid |