| BioBlocks Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (858) 558-5900 | |||
![]() |
sales@bioblocks.com | |||
| Chemical manufacturer | ||||
| IRIS Biotech GmbH | Germany | Inquire | ||
|---|---|---|---|---|
![]() |
+49 (9231) 961-973 | |||
![]() |
info@iris-biotech.de | |||
| Chemical manufacturer since 1788 | ||||
| Matrix Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Squarix GmbH | Germany | Inquire | ||
|---|---|---|---|---|
![]() |
+49 (2365) 915-278/ | |||
![]() |
order@squarix.de,info@squarix.de | |||
| Chemical manufacturer since 1992 | ||||
| Name | (1R,2S)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-cyclohexene-1-carboxylic acid |
|---|---|
| Synonyms | (1R,2S)-2 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.28 |
| CAS Registry Number | 870288-16-7 |
| SMILES | O=C(O)[C@H]1[C@@H](NC(=O)OC(C)(C)C)\C=C/CC1 |
| InChI | 1S/C12H19NO4/c1-12(2,3)17-11(16)13-9-7-5-4-6-8(9)10(14)15/h5,7-9H,4,6H2,1-3H3,(H,13,16)(H,14,15)/t8-,9+/m1/s1 |
| InChIKey | QWRRLPZJKAWOFL-BDAKNGLRSA-N |
| Density | 1.156g/cm3 (Cal.) |
|---|---|
| Boiling point | 399.2°C at 760 mmHg (Cal.) |
| Flash point | 195.229°C (Cal.) |
| Refractive index | 1.511 (Cal.) |
| Safety Description | IRRITANT |
|---|---|
| SDS | Available |
| (1) | Loránd Kiss, Enikő Forró, Santos Fustero and Ferenc Fülöp. Regio- and diastereoselective fluorination of alicyclic β-amino acids, Org. Biomol. Chem., 2011, 9, 6528. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (1R,2S)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-cyclohexene-1-carboxylic acid |