|
CAS#: 87050-83-7 Product: 2,2'-(1,2-Ethanediyl)bis[6-(bromomethyl)-1,4-benzoquinone] No suppilers available for the product. |
| Name | 2,2'-(1,2-Ethanediyl)bis[6-(bromomethyl)-1,4-benzoquinone] |
|---|---|
| Synonyms | 2-(bromom |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12Br2O4 |
| Molecular Weight | 428.07 |
| CAS Registry Number | 87050-83-7 |
| SMILES | C1=C(C(=O)C(=CC1=O)CBr)CCC2=CC(=O)C=C(C2=O)CBr |
| InChI | 1S/C16H12Br2O4/c17-7-11-5-13(19)3-9(15(11)21)1-2-10-4-14(20)6-12(8-18)16(10)22/h3-6H,1-2,7-8H2 |
| InChIKey | FKLTWNNPUGYMDH-UHFFFAOYSA-N |
| Density | 1.7±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 487.9±45.0°C at 760 mmHg (Cal.) |
| Flash point | 124.0±15.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2'-(1,2-Ethanediyl)bis[6-(bromomethyl)-1,4-benzoquinone] |