Online Database of Chemicals from Around the World
|
CAS#: 87081-56-9 Product: Methyl (2E,3S,4S,5E)-6-(4-chloro-3-methoxyphenyl)-4-methoxy-2-(methoxymethylene)-3-methyl-5-hexenoate No suppilers available for the product. |
| Name | Methyl (2E,3S,4S,5E)-6-(4-chloro-3-methoxyphenyl)-4-methoxy-2-(methoxymethylene)-3-methyl-5-hexenoate |
|---|---|
| Synonyms | (-)-OUDEMANSIN B |
| Molecular Structure |  |
| Molecular Formula | C18H23ClO5 |
| Molecular Weight | 354.83 |
| CAS Registry Number | 87081-56-9 |
| SMILES | C[C@H]([C@H](/C=C/C1=CC(=C(C=C1)Cl)OC)OC)/C(=C\OC)/C(=O)OC |
| InChI | 1S/C18H23ClO5/c1-12(14(11-21-2)18(20)24-5)16(22-3)9-7-13-6-8-15(19)17(10-13)23-4/h6-12,16H,1-5H3/b9-7+,14-11+/t12-,16-/m0/s1 |
| InChIKey | DPNYGWABRKPFDE-PQHZCZHCSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 469.3±45.0°C at 760 mmHg (Cal.) |
| Flash point | 166.3±27.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (2E,3S,4S,5E)-6-(4-chloro-3-methoxyphenyl)-4-methoxy-2-(methoxymethylene)-3-methyl-5-hexenoate |