|
CAS#: 871101-31-4 Product: 2-[4-(Dimethylamino)phenyl]-6-iodo-4H-chromen-4-one No suppilers available for the product. |
| Name | 2-[4-(Dimethylamino)phenyl]-6-iodo-4H-chromen-4-one |
|---|---|
| Synonyms | 2-(4-Dimethylaminophenyl)-6-iodo-4-chromenone; 2-(4-Dimethylamino-phenyl)-6-iodo-chromen-4-one; 6-iodo-4'-dimethyaminoflavone |
| Molecular Structure | ![]() |
| Molecular Formula | C17H14INO2 |
| Molecular Weight | 391.20 |
| CAS Registry Number | 871101-31-4 |
| SMILES | CN(C)C1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C=CC(=C3)I |
| InChI | 1S/C17H14INO2/c1-19(2)13-6-3-11(4-7-13)17-10-15(20)14-9-12(18)5-8-16(14)21-17/h3-10H,1-2H3 |
| InChIKey | MVKVWWKDDYBNOJ-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 488.6±45.0°C at 760 mmHg (Cal.) |
| Flash point | 249.3±28.7°C (Cal.) |
| Refractive index | 1.689 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[4-(Dimethylamino)phenyl]-6-iodo-4H-chromen-4-one |