|
CAS#: 871131-52-1 Product: 4-Amino-5H-chromeno[4,3-d]pyrimidin-5-one No suppilers available for the product. |
| Name | 4-Amino-5H-chromeno[4,3-d]pyrimidin-5-one |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H7N3O2 |
| Molecular Weight | 213.19 |
| CAS Registry Number | 871131-52-1 |
| SMILES | C1=CC=C2C(=C1)C3=C(C(=NC=N3)N)C(=O)O2 |
| InChI | 1S/C11H7N3O2/c12-10-8-9(13-5-14-10)6-3-1-2-4-7(6)16-11(8)15/h1-5H,(H2,12,13,14) |
| InChIKey | ANSYCHQJSHLCLB-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 485.8±33.0°C at 760 mmHg (Cal.) |
| Flash point | 247.6±25.4°C (Cal.) |
| Refractive index | 1.716 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Amino-5H-chromeno[4,3-d]pyrimidin-5-one |