|
CAS#: 87148-01-4 Product: 2-Ethylhexyl 2-acetyl-5-phenyl-2,4-pentadienoate No suppilers available for the product. |
| Name | 2-Ethylhexyl 2-acetyl-5-phenyl-2,4-pentadienoate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 |
| CAS Registry Number | 87148-01-4 |
| EINECS | 289-301-8 |
| SMILES | CCC(CCCC)COC(=O)C(=CC=Cc1ccccc1)C(C)=O |
| InChI | 1S/C21H28O3/c1-4-6-11-18(5-2)16-24-21(23)20(17(3)22)15-10-14-19-12-8-7-9-13-19/h7-10,12-15,18H,4-6,11,16H2,1-3H3 |
| InChIKey | COGSJLDNUHGNQV-UHFFFAOYSA-N |
| Density | 1.017g/cm3 (Cal.) |
|---|---|
| Boiling point | 462.704°C at 760 mmHg (Cal.) |
| Flash point | 200.017°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Ethylhexyl 2-acetyl-5-phenyl-2,4-pentadienoate |