|
CAS#: 871586-76-4 Product: Ethyl 6-(difluoromethoxy)-2,3,4,9-tetrahydro-1H-carbazole-1-carboxylate No suppilers available for the product. |
| Name | Ethyl 6-(difluoromethoxy)-2,3,4,9-tetrahydro-1H-carbazole-1-carboxylate |
|---|---|
| Synonyms | 1H-CARBAZ |
| Molecular Structure | ![]() |
| Molecular Formula | C16H17F2NO3 |
| Molecular Weight | 309.31 |
| CAS Registry Number | 871586-76-4 |
| SMILES | FC(F)Oc3ccc1c(c2c(n1)C(C(=O)OCC)CCC2)c3 |
| InChI | 1S/C16H17F2NO3/c1-2-21-15(20)11-5-3-4-10-12-8-9(22-16(17)18)6-7-13(12)19-14(10)11/h6-8,11,16,19H,2-5H2,1H3 |
| InChIKey | HRNXWTWMHYIKIZ-UHFFFAOYSA-N |
| Density | 1.299g/cm3 (Cal.) |
|---|---|
| Boiling point | 432.628°C at 760 mmHg (Cal.) |
| Flash point | 215.446°C (Cal.) |
| Refractive index | 1.568 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 6-(difluoromethoxy)-2,3,4,9-tetrahydro-1H-carbazole-1-carboxylate |