|
CAS#: 871814-54-9 Product: 7-Amino-3-(4-chlorophenyl)-2-isopropyl-8-methoxy-4(3H)-quinazolinone No suppilers available for the product. |
| Name | 7-Amino-3-(4-chlorophenyl)-2-isopropyl-8-methoxy-4(3H)-quinazolinone |
|---|---|
| Synonyms | 4(3H)-QUI |
| Molecular Structure | ![]() |
| Molecular Formula | C18H18ClN3O2 |
| Molecular Weight | 343.81 |
| CAS Registry Number | 871814-54-9 |
| SMILES | CC(C)c1nc2c(ccc(c2OC)N)c(=O)n1c3ccc(cc3)Cl |
| InChI | 1S/C18H18ClN3O2/c1-10(2)17-21-15-13(8-9-14(20)16(15)24-3)18(23)22(17)12-6-4-11(19)5-7-12/h4-10H,20H2,1-3H3 |
| InChIKey | SLOXPZFBNAEIDS-UHFFFAOYSA-N |
| Density | 1.325g/cm3 (Cal.) |
|---|---|
| Boiling point | 551.735°C at 760 mmHg (Cal.) |
| Flash point | 287.479°C (Cal.) |
| Refractive index | 1.636 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Amino-3-(4-chlorophenyl)-2-isopropyl-8-methoxy-4(3H)-quinazolinone |