|
CAS#: 87202-63-9 Product: 5,5'-(1,10-Decanediyldisulfanediyl)bis(1,3,4-thiadiazol-2-amine) No suppilers available for the product. |
| Name | 5,5'-(1,10-Decanediyldisulfanediyl)bis(1,3,4-thiadiazol-2-amine) |
|---|---|
| Synonyms | NSC360364 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H24N6S4 |
| Molecular Weight | 404.64 |
| CAS Registry Number | 87202-63-9 |
| SMILES | S(c1nnc(s1)N)CCCCCCCCCCSc2nnc(s2)N |
| InChI | 1S/C14H24N6S4/c15-11-17-19-13(23-11)21-9-7-5-3-1-2-4-6-8-10-22-14-20-18-12(16)24-14/h1-10H2,(H2,15,17)(H2,16,18) |
| InChIKey | LAHMUFITSUPBFF-UHFFFAOYSA-N |
| Density | 1.35g/cm3 (Cal.) |
|---|---|
| Boiling point | 623.233°C at 760 mmHg (Cal.) |
| Flash point | 330.72°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,5'-(1,10-Decanediyldisulfanediyl)bis(1,3,4-thiadiazol-2-amine) |