|
CAS#: 87240-31-1 Product: Dimethyl 4-{2-[(difluoromethyl)sulfanyl]phenyl}-2,6-dimethyl-1,4-dihydro-3,5-pyridinedicarboxylate No suppilers available for the product. |
| Name | Dimethyl 4-{2-[(difluoromethyl)sulfanyl]phenyl}-2,6-dimethyl-1,4-dihydro-3,5-pyridinedicarboxylate |
|---|---|
| Synonyms | 2,6-Dimet |
| Molecular Structure | ![]() |
| Molecular Formula | C18H19F2NO4S |
| Molecular Weight | 383.41 |
| CAS Registry Number | 87240-31-1 |
| SMILES | O=C(OC)\C1=C(\N/C(=C(/C(=O)OC)C1c2ccccc2SC(F)F)C)C |
| InChI | 1S/C18H19F2NO4S/c1-9-13(16(22)24-3)15(14(10(2)21-9)17(23)25-4)11-7-5-6-8-12(11)26-18(19)20/h5-8,15,18,21H,1-4H3 |
| InChIKey | SXDFGSZLXVWKIJ-UHFFFAOYSA-N |
| Density | 1.311g/cm3 (Cal.) |
|---|---|
| Boiling point | 436.421°C at 760 mmHg (Cal.) |
| Flash point | 217.74°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl 4-{2-[(difluoromethyl)sulfanyl]phenyl}-2,6-dimethyl-1,4-dihydro-3,5-pyridinedicarboxylate |