|
CAS#: 87255-09-2 Product: 8-Isopropenyl-2,3-dimethoxy-5-methyl-5-vinyl-5,6,7,8-tetrahydro-1,4-naphthalenedione No suppilers available for the product. |
| Name | 8-Isopropenyl-2,3-dimethoxy-5-methyl-5-vinyl-5,6,7,8-tetrahydro-1,4-naphthalenedione |
|---|---|
| Synonyms | Arnebinone; C10302 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.36 |
| CAS Registry Number | 87255-09-2 |
| SMILES | O=C1\C2=C(/C(=O)C(/OC)=C1/OC)C(\C(=C)C)CCC2(\C=C)C |
| InChI | 1S/C18H22O4/c1-7-18(4)9-8-11(10(2)3)12-13(18)15(20)17(22-6)16(21-5)14(12)19/h7,11H,1-2,8-9H2,3-6H3 |
| InChIKey | OXNJGMNJOVOFOW-UHFFFAOYSA-N |
| Density | 1.115g/cm3 (Cal.) |
|---|---|
| Boiling point | 440.936°C at 760 mmHg (Cal.) |
| Flash point | 193.548°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Isopropenyl-2,3-dimethoxy-5-methyl-5-vinyl-5,6,7,8-tetrahydro-1,4-naphthalenedione |