|
CAS#: 87270-38-0 Product: N-{[1-(4-Chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]acetyl}-S-methyl-L-cysteine No suppilers available for the product. |
| Name | N-{[1-(4-Chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]acetyl}-S-methyl-L-cysteine |
|---|---|
| Synonyms | Alanine, |
| Molecular Structure | ![]() |
| Molecular Formula | C23H23ClN2O5S |
| Molecular Weight | 474.96 |
| CAS Registry Number | 87270-38-0 |
| SMILES | O=C(O)[C@@H](NC(=O)Cc2c1cc(OC)ccc1n(c2C)C(=O)c3ccc(Cl)cc3)CSC |
| InChI | 1S/C23H23ClN2O5S/c1-13-17(11-21(27)25-19(12-32-3)23(29)30)18-10-16(31-2)8-9-20(18)26(13)22(28)14-4-6-15(24)7-5-14/h4-10,19H,11-12H2,1-3H3,(H,25,27)(H,29,30)/t19-/m0/s1 |
| InChIKey | XWAHPUCZLAPTPG-IBGZPJMESA-N |
| Density | 1.36g/cm3 (Cal.) |
|---|---|
| Boiling point | 686.906°C at 760 mmHg (Cal.) |
| Flash point | 369.228°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-{[1-(4-Chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]acetyl}-S-methyl-L-cysteine |