|
CAS#: 873016-31-0 Product: 2-Methyl-2-propanyl 4,5,7,8-tetrahydro-6H-thieno[2,3-d]azepine-6-carboxylate No suppilers available for the product. |
| Name | 2-Methyl-2-propanyl 4,5,7,8-tetrahydro-6H-thieno[2,3-d]azepine-6-carboxylate |
|---|---|
| Synonyms | 2-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.36 |
| CAS Registry Number | 873016-31-0 |
| SMILES | CC(C)(C)OC(=O)N1CCc2ccsc2CC1 |
| InChI | 1S/C13H19NO2S/c1-13(2,3)16-12(15)14-7-4-10-6-9-17-11(10)5-8-14/h6,9H,4-5,7-8H2,1-3H3 |
| InChIKey | RWAYLEURMSJXJJ-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 355.8±42.0°C at 760 mmHg (Cal.) |
| Flash point | 169.0±27.9°C (Cal.) |
| Refractive index | 1.542 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-propanyl 4,5,7,8-tetrahydro-6H-thieno[2,3-d]azepine-6-carboxylate |