|
CAS#: 87303-94-4 Product: 1,6-Dithiabenz(3,4)Estra-3,5(10),8,14-Tetraen-17-One No suppilers available for the product. |
| Name | 1,6-Dithiabenz(3,4)Estra-3,5(10),8,14-Tetraen-17-One |
|---|---|
| Synonyms | 1,6-Dithiabenz(3,4)Estra-3,5(10),8,14-Tetraen-17-One; 3H-Indeno(5',4':4,5)Thiopyrano(3,2-C)(2)Benzothiopyran-3-One, 2,3A,4,5,7,13-Hexahydro-3A-Methyl-, (+-)- |
| Molecular Structure | ![]() |
| Molecular Formula | C20H18OS2 |
| Molecular Weight | 338.48 |
| CAS Registry Number | 87303-94-4 |
| SMILES | [C@@]15(C(=CCC1=O)C2=C(C3=C(SC2)C4=C(CS3)C=CC=C4)CC5)C |
| InChI | 1S/C20H18OS2/c1-20-9-8-14-15(16(20)6-7-17(20)21)11-23-18-13-5-3-2-4-12(13)10-22-19(14)18/h2-6H,7-11H2,1H3/t20-/m0/s1 |
| InChIKey | WAPGFRWUVYAQOC-FQEVSTJZSA-N |
| Density | 1.364g/cm3 (Cal.) |
|---|---|
| Boiling point | 611.419°C at 760 mmHg (Cal.) |
| Flash point | 272.125°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,6-Dithiabenz(3,4)Estra-3,5(10),8,14-Tetraen-17-One |