Online Database of Chemicals from Around the World
|
CAS#: 87356-51-2 Product: 3-(2-Fluorophenyl)-2-Methyl-4(3H)-Pyrimidinone No suppilers available for the product. |
| Name | 3-(2-Fluorophenyl)-2-Methyl-4(3H)-Pyrimidinone |
|---|---|
| Synonyms | 3-(2-Fluorophenyl)-2-Methyl-Pyrimidin-4-One; 3-(2-Fluorophenyl)-2-Methyl-4-Pyrimidinone; 3-(2-Fluorophenyl)-2-Methyl-4(3H)-Pyrimidinone |
| Molecular Structure |  |
| Molecular Formula | C11H9FN2O |
| Molecular Weight | 204.20 |
| CAS Registry Number | 87356-51-2 |
| SMILES | C1=C(C(=CC=C1)N2C(=NC=CC2=O)C)F |
| InChI | 1S/C11H9FN2O/c1-8-13-7-6-11(15)14(8)10-5-3-2-4-9(10)12/h2-7H,1H3 |
| InChIKey | QWIZBSBIOVSMMA-UHFFFAOYSA-N |
| Density | 1.219g/cm3 (Cal.) |
|---|---|
| Boiling point | 300.455°C at 760 mmHg (Cal.) |
| Flash point | 135.511°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2-Fluorophenyl)-2-Methyl-4(3H)-Pyrimidinone |