Online Database of Chemicals from Around the World
|
CAS#: 873998-64-2 Product: 1-(2-Chloro-3-ethoxyphenyl)-3-(4-ethoxyphenyl)thiourea No suppilers available for the product. |
| Name | 1-(2-Chloro-3-ethoxyphenyl)-3-(4-ethoxyphenyl)thiourea |
|---|---|
| Synonyms | 1-(2-Chlor-3-ethoxyphenyl)-3-(4-ethoxyphenyl)thioharnstoff; 1-(2-Chloro-3-ethoxyphenyl)-3-(4-ethoxyphenyl)thiourea; 1-(2-Chloro-3-éthoxyphényl)-3-(4-éthoxyphényl)thiourée |
| Molecular Structure |  |
| Molecular Formula | C17H19ClN2O2S |
| Molecular Weight | 350.86 |
| CAS Registry Number | 873998-64-2 |
| SMILES | CCOc1ccc(cc1)NC(=S)Nc2cccc(c2Cl)OCC |
| InChI | 1S/C17H19ClN2O2S/c1-3-21-13-10-8-12(9-11-13)19-17(23)20-14-6-5-7-15(16(14)18)22-4-2/h5-11H,3-4H2,1-2H3,(H2,19,20,23) |
| InChIKey | WRUGUWJLBJVBIQ-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 460.2±55.0°C at 760 mmHg (Cal.) |
| Flash point | 232.1±31.5°C (Cal.) |
| Refractive index | 1.659 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Chloro-3-ethoxyphenyl)-3-(4-ethoxyphenyl)thiourea |