Online Database of Chemicals from Around the World
| ChemBridge Corporation | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (858) 451-7400 | |||
 |
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | Ethyl 4-benzyl-4-piperidinecarboxylate |
|---|---|
| Synonyms | 4-Benzyl-4-pipéridinecarboxylate d'éthyle; 4-Piperidinecarboxylic acid, 4-(phenylmethyl)-, ethyl ester |
| Molecular Structure |  |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.33 |
| CAS Registry Number | 874440-85-4 |
| SMILES | CCOC(=O)C1(CCNCC1)Cc2ccccc2 |
| InChI | 1S/C15H21NO2/c1-2-18-14(17)15(8-10-16-11-9-15)12-13-6-4-3-5-7-13/h3-7,16H,2,8-12H2,1H3 |
| InChIKey | CAPDUHXHHVMIOJ-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.9±37.0°C at 760 mmHg (Cal.) |
| Flash point | 166.0±26.5°C (Cal.) |
| Refractive index | 1.521 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 4-benzyl-4-piperidinecarboxylate |