|
CAS#: 874571-92-3 Product: 3-Cyclohexyl-2,6-diphenyl-3H-thieno[2,3-d]imidazole-5-carboxylic acid No suppilers available for the product. |
| Name | 3-Cyclohexyl-2,6-diphenyl-3H-thieno[2,3-d]imidazole-5-carboxylic acid |
|---|---|
| Synonyms | 3H-THIENO |
| Molecular Structure | ![]() |
| Molecular Formula | C24H22N2O2S |
| Molecular Weight | 402.51 |
| CAS Registry Number | 874571-92-3 |
| SMILES | O=C(O)c4sc1c(nc(n1C2CCCCC2)c3ccccc3)c4c5ccccc5 |
| InChI | 1S/C24H22N2O2S/c27-24(28)21-19(16-10-4-1-5-11-16)20-23(29-21)26(18-14-8-3-9-15-18)22(25-20)17-12-6-2-7-13-17/h1-2,4-7,10-13,18H,3,8-9,14-15H2,(H,27,28) |
| InChIKey | QYDMVGGYXJPTBI-UHFFFAOYSA-N |
| Density | 1.338g/cm3 (Cal.) |
|---|---|
| Boiling point | 625.44°C at 760 mmHg (Cal.) |
| Flash point | 332.054°C (Cal.) |
| Refractive index | 1.705 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Cyclohexyl-2,6-diphenyl-3H-thieno[2,3-d]imidazole-5-carboxylic acid |