|
CAS#: 874752-05-3 Product: [2-(5-Nitro-1H-indol-2-yl)phenyl]methanol No suppilers available for the product. |
| Name | [2-(5-Nitro-1H-indol-2-yl)phenyl]methanol |
|---|---|
| Synonyms | BENZENEMETHANOL, 2-(5-NITRO-1H-INDOL-2-YL)- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12N2O3 |
| Molecular Weight | 268.27 |
| CAS Registry Number | 874752-05-3 |
| SMILES | C1=CC=C(C(=C1)CO)C2=CC3=C(N2)C=CC(=C3)[N+](=O)[O-] |
| InChI | 1S/C15H12N2O3/c18-9-10-3-1-2-4-13(10)15-8-11-7-12(17(19)20)5-6-14(11)16-15/h1-8,16,18H,9H2 |
| InChIKey | AEWWEYQTIRUIET-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 563.4±45.0°C at 760 mmHg (Cal.) |
| Flash point | 294.5±28.7°C (Cal.) |
| Refractive index | 1.72 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [2-(5-Nitro-1H-indol-2-yl)phenyl]methanol |