|
CAS#: 874990-90-6 Product: 1-Benzyl-4-(2,4-dichlorophenyl)-3-pyrrolidinecarboxylic acid No suppilers available for the product. |
| Name | 1-Benzyl-4-(2,4-dichlorophenyl)-3-pyrrolidinecarboxylic acid |
|---|---|
| Synonyms | 3-PYRROLI |
| Molecular Structure | ![]() |
| Molecular Formula | C18H17Cl2NO2 |
| Molecular Weight | 350.24 |
| CAS Registry Number | 874990-90-6 |
| SMILES | Clc1ccc(c(Cl)c1)C3C(C(=O)O)CN(Cc2ccccc2)C3 |
| InChI | 1S/C18H17Cl2NO2/c19-13-6-7-14(17(20)8-13)15-10-21(11-16(15)18(22)23)9-12-4-2-1-3-5-12/h1-8,15-16H,9-11H2,(H,22,23) |
| InChIKey | YQSKYFYLKJOQMT-UHFFFAOYSA-N |
| Density | 1.355g/cm3 (Cal.) |
|---|---|
| Boiling point | 481.45°C at 760 mmHg (Cal.) |
| Flash point | 244.972°C (Cal.) |
| Refractive index | 1.626 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Benzyl-4-(2,4-dichlorophenyl)-3-pyrrolidinecarboxylic acid |