|
CAS#: 875-63-8 Product: Trans-Decahydro-1-Methylquinoline No suppilers available for the product. |
| Name | Trans-Decahydro-1-Methylquinoline |
|---|---|
| Synonyms | Trans-Decahydro-1-Methylquinoline; (4As,8Ar)-1-Methyldecahydroquinoline |
| Molecular Structure | ![]() |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 |
| CAS Registry Number | 875-63-8 |
| EINECS | 212-875-8 |
| SMILES | [C@@H]12CCCC[C@H]1N(CCC2)C |
| InChI | 1S/C10H19N/c1-11-8-4-6-9-5-2-3-7-10(9)11/h9-10H,2-8H2,1H3/t9-,10+/m0/s1 |
| InChIKey | AAARTTJTRNAYHQ-VHSXEESVSA-N |
| Density | 0.904g/cm3 (Cal.) |
|---|---|
| Boiling point | 198.294°C at 760 mmHg (Cal.) |
| Flash point | 74.966°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trans-Decahydro-1-Methylquinoline |