|
CAS#: 87549-36-8 Product: N-{4-[(2-Methyl-4-oxo-4H-1,3-benzodioxin-2-yl)oxy]phenyl}acetamide No suppilers available for the product. |
| Name | N-{4-[(2-Methyl-4-oxo-4H-1,3-benzodioxin-2-yl)oxy]phenyl}acetamide |
|---|---|
| Synonyms | Acetamide |
| Molecular Structure | ![]() |
| Molecular Formula | C17H15NO5 |
| Molecular Weight | 313.30 |
| CAS Registry Number | 87549-36-8 |
| SMILES | CC(=O)NC1=CC=C(C=C1)OC2(OC3=CC=CC=C3C(=O)O2)C |
| InChI | 1S/C17H15NO5/c1-11(19)18-12-7-9-13(10-8-12)21-17(2)22-15-6-4-3-5-14(15)16(20)23-17/h3-10H,1-2H3,(H,18,19) |
| InChIKey | ZAPRLADYRFPQSH-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 590.0±50.0°C at 760 mmHg (Cal.) |
| Flash point | 310.6±30.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-{4-[(2-Methyl-4-oxo-4H-1,3-benzodioxin-2-yl)oxy]phenyl}acetamide |